Organic Chemistry Questions

How many MOLES of carbon tetrafluoride are present in 1.04 grams of this compound? How many GRAMS of carbon tetrafluoride are present in 3.11 moles of this compound?

A sample of Mg weighs 13.3 grams. Will a sample of B that contains the same number of atoms weigh more or less than 13.3 grams? (more, less): Calculate the mass of a sample of B that contains the same number of atoms. grams of B

Carry out the following mathematical operation: 29.34 24.76 Identify the number of significant figures for the answer of this operation. significant figure(s) What is the result of this calculation (when reported to the correct number of significant figures)? Carry out the following mathematical operation: 29.34 - 24.76 b. Identify the number of decimal places for the answer of this operation. What is the result of this calculation (when reported to the correct number of decimal places)?

Carry out the following mathematical operation: 94.73 x 95.977 Identify the number of significant figures for the answer of this operation.

According to the following reaction: 6HC1 (aq) + Fe₂O3 (s)-3H₂O (1) + 2FeCl3 (aq) What would you multiply "grams of hydrochloric acid" by to convert to the units "moles of iron(III) oxide" ?

For the molecular compound boron trifluoride, what would you multiply "grams of BF3" by to get the units "moles of BF3 "?

Over the years, the thermite reaction has been used for welding railroad rails, in incendiary bombs, and to ignite solid fuel rocket motors. The reaction is Fe₂O3(s) + 2Al(s) → 2Fe() + Al2O3(s) Click here to see the reaction. What mass of aluminum must be used to produce 93.81 g of iron?

For the molecular compound phosphorus trichloride, what would you multiply "grams of PCI, " by to get the units "molecules of PCI3?

A graduated cylinder with a mass of 105.56 g has 45.4 mL of a certain liquid added to it. The mass of the cylinder and the liquid is 145.10 g. What is the density of this liquid? Density= g/mL.

According to the following reaction: Cl₂ (g) + 2Nal (s)→→→ 2NaCl (s) + 1₂ (s) What would you multiply "grams of chlorine" by to convert to the units "moles of sodium iodide"?

When carbon monoxide reacts with water, carbon dioxide and hydrogen are produced. The balanced equation for this reaction is: CO(g) + H₂O (l) CO₂ (g) + H₂ (g) If 3 moles of carbon monoxide react, The reaction consumes __ moles of water The reaction produces __ moles of carbon dioxide and moles of hydrogen

A sample of Xe weighs 41.0 grams. Will a sample of P that contains the same number of atoms weigh more or less than 41.0 grams? (more, less): Calculate the mass of a sample of P that contains the same number of atoms.

For the following reaction, 5.45 grams of sulfur dioxide are mixed with excess oxygen gas. The reaction yields 5.17 grams of sulfur trioxide. sulfur dioxide (g) + oxygen (g)-sulfur trioxide (g) What is the theoretical yield of sulfur trioxide ? What is the percent yield for this reaction ?

Carry out the following mathematical operation: 20.684 / 13.84 Identify the number of significant figures for the answer of this operation. What is the result of this calculation (when reported to the correct number of significant figures)? Carry out the following mathematical operation: 20.684-13.84 b. Identify the number of decimal places for the answer of this operation. What is the result of this calculation (when reported to the correct number of decimal places)?

According to the following reaction, how many moles of water will be formed upon the complete reaction of 0.419 moles hydrogen peroxide (H₂O₂)? hydrogen peroxide (H₂O₂) (aq)-water (1)+ oxygen __ (g) moles water

The increase in the boiling point of a solution is given by the equation: AT= Kmi Where: AT=boiling point elevation Kboiling point elevation constant m = molality of the solution i = van't Hoff factor In order to solve for the van't Hoff factor, i, you must multiply both sides of the equation by the same expression: AT X __ = Kmi x__ The resulting equation is: 1-

When potassium hydroxide reacts with phosphoric acid, potassium phosphate and water are produced. The balanced equation for this reaction is: 3KOH (aq) + H₂PO4 (aq) →K3PO4 (aq) + 3H₂O (1) If 6 moles of potassium hydroxide react, The reaction consumes __ moles of phosphoric acid The reaction produces__ moles of potassium phosphate and, moles of water

What does it mean ti say that the cell is 33% effective in storing the energy from the complete metabloism of glucose?

Write the molecular formula of the following: 5) 2-methylbutane 6) 2,3-dibromo-1-pentene 7) 3-bromo-1-pentyne 8) 1,3-diethylbenzene 9) 2,4-diisopropylbenzoic acid 10) 3,3-dichloro-2,2-dimethylhexane 11) 3-fluoro-2-methyl-1-butene 12) 1-ethylcyclopropane 13) meta-propyltoluene 14) Cis-3,4-diiodio-3-heptene

Draw the expanded structures for the following alkenes, cyclic alkenes, and alkynes: a) noncyclic alkenes that contain 4 carbon atoms (three possible) b) cyclic alkenes that contain 4 carbon atoms (four possible) c) alkynes that contain 4 carbon atoms (two possible, neither of them are cyclic alkynes)

Alkenes: 1) Draw the line angle formula for cis-2,3-dibromobutane and for trans-2,3-dibromobutane. 2) Draw as many isomers as you can with the formula C6H10 (linear and cyclic). Name all the structures.

Draw the following and write the molecular formula: 3) 1-iodo-2-methylbenzene 4) cis-1,2-dichloroethene 5) cis-2-pentene 6)5-chloro-4-ethyl-2-heptyne 7) 3-methyl-1-butene 8) 4-chloro-1-cycloheptene 9) 4-bromo-2chlorophenol 10) 4-chloro-1-iodo-2-hexyne

The Nitration reaction of methyl benzoate only shows meta product forming. Suppose you reran the experiment with toluene instead of methyl benzoate. What would be the major product(s) from nitration of toluene?

Which statement best describes why the equilibrium constant is a large number (greater than 1) in this simulation? a. At equilibrium the concentration of product is equal to the concentration of reactants. b. At equilibrium there is significantly less product than reactant. C. At equilibrium there is significantly more product than reactant.

Complete and balance the following redox reaction in basic solution Zn(s) →→→ Zn(OH)²(aq) + H₂(g)

What is the ppm of Ca²+ in a 15 mL of solution if it is found that there is 98 micro-grams of calcium in the sample? (1 gram = 1,000,000 micro-grams)? O 0.15 ppm O 98 ppm O 15 ppm O 6.5 ppm

Balance the following redox reaction in basic condition. (b) After balancing the equation, indicate which species is a reducing agent and an oxidizing agent. Al (s) + MnO, (aq) → MnO₂ (s) + Al(OH)4 (aq)

Which of the following best describes heat? The measure of the average kinetic energy The transfer of kinetic energy from a hot to a cooler object The transfer of potential energy from a hot to a cooler object The total internal energy of a substance at a constant pressure

In the ground state of mercury, Hg, a. how many electrons occupy atomic orbitals with n = 6? electron(s) b. how many electrons occupy s atomic orbitals? electron(s) c. how many electrons occupy p, atomic orbitals? electron(s) d. how many electrons have spin "up" (m, = + ₂)? electron(s)

A mixture initially contains A, B, and C in the following concentrations: [A] = 0.550 M. [B] =1.40 M. and [C] = 0.300 M. The following reaction occurs and equilibrium is established: A + 2B=C At equilibrium, [A] = 0.390 Mand [C] = 0.460 M. Calculate the value of the equilibrium constant, K. Express your answer numerically.

On a piece of scratch paper draw structural formulas for all of the constitutional isomers that would be named as a dichloroethane. The number of compounds is

Heating 4-chlorotoluene and aqueous sodium hydroxide at high pressure followed by addition of aqueous acid forms: (a) two isomeric compounds of formula C7H8O (b) a single compound of formula C7H8O (c) three isomeric compounds of formula C7H8O (d) a single compound of formula C6H6O (e) no new compound(s) is/are formed a b c d e

5. Derive the Lewis structures for the following species: N2O4, NO2-, CIO3-, IC4-, I3-, SF4, SbF5, IF4+. Predict the geometry for all the preceding species then suggest their molecular geometries.

Choose four ways in which the Brønsted-Lowry concept expands on the Arrhenius concept. (Select all that apply.) It expands the concept of a base to include any species that accepts protons. It allows some species to be considered as acids or bases, depending on the other reactant with which they are mixed. It enables us to write acid-base reactions not only in liquid solutions but in gaseous solutions. It expands the concept of a base to include the compounds containing the OH- ion, not just the OH- ion. It enlarges the concepts of acids and bases to include lons as well as molecules. It enlarges the concepts of acids and bases to include ionic compounds as well as non-ionic compounds. It enables us to write acid-base reactions not only in aqueous solutions but in nonaqueous solutions.

An organism uses the following reaction to generate free energy: CH4 + SO4 2- + 2H+ -> H2S + CO2 + 2H2O which of the following would increase the amount of free energy available to this organism? There is more than one correct answer, select all that apply to receive credit. The H₂S concentration were to go down. The CH4 concentration were to increase. The SO42 were to decrease The pH were to decrease The CH4 concentration were to decrease The CO₂ were to increase

When para-bromotoluene is treated with sodium amide two products are obtained. For the mechanism, draw the curved arrows as needed. Include lone pairs and charges in your answer. Do not draw out any hydrogen explicitly in your products. Do not use abbreviations such as Me or Ph.

Which of the test metals in experiment 5 exhibited the greatest reactivity towards H₂O? Ca Al Mg

Example #2: Calculate the enthalpy of the following chemical reaction: CS2(l) + 3O2(g) ---> CO2(g) + 2SO2(g) Given: C(s) + O2(g) ---> CO2(g) ΔH = -393.5 kJ/mol S(s) + O2(g) ---> SO2(g) ΔH = -296.8 kJ/mol C(s) + 2S(s) ---> CS2(l) ΔH = +87.9 kJ/mol

Draw the major product(s) obtained when each of the following compounds is treated with fuming sulfuric acid.

During its orbit, the Earth's minimum distance from the sun is approximately 148 million kilometers. Which of the following correctly represents this number in scientific notation? 1.48 x 10^8 1.48 x 10^4 1.48 x 10^-7 148,000,000

(2) Find the AH for the reaction below, given the following reactions and subsequent ΔH values: 2CO2(g) + H2O(g) → C2H2(g) + 5/2O2(g) C2H2(g) + 2H2(g) → C2H6(g) ΔH =-94.5 kJ H2O(g) --> H2(g) + 1/2O2 (g) ΔH =71.2 kJ C2H6(g) + 7/2O2(g) → 2CO2(g) + 3H2O(g) ΔH =-283 kJ answer= 235 kJ

When the following equation is balanced using the smallest possible integers, what is the number in front of the substance in bold type? Pb(NO3)2 + K2CO3 --> PbCO3 + KNO3 5 4 3 2 1

You have two beakers on your lab table. Beaker #1 contains 32.07 g of sulfur and Beaker #2 contains 74.92 g of arsenic (As). Which beaker contains the greatest number of atoms? Choose the best answer. Beaker #1 because one sulfur atom weighs less than one arsenic atom so you need more of the sulfur atoms to fill the beaker. Beaker #1 because it contains more moles of sulfur atoms than the number of moles of arsenic atoms in Beaker #2. Beaker #2 because arsenic has a greater mass than sulfur. Beaker #2 because it contains more moles of arsenic atoms than the number of moles of sulfur atoms in Beaker #1. Beakers #1 and #2 contain the same number of atoms because there is one mole in each.

9. Build a model of CH₂BrCI. Next, build a model of the mirror image of your first molecule. How are these models related? 10. Build a model of CHBrCIF. Next, build of model of the mirror image of your first molecule. How are these molecules related?

Show all your work! 1. Calculate the specific heat for an object that absorbs 145 J of heat and has 35.6 g and changes from 58°C to 74°C.

For the balanced equation below, someone combines 49.7 g of ammonium sulfate (molar mass = 132.16 g/mol) and excess calcium hydroxide to create three products. 1) How many moles of ammonia (NH3) are created? 2) How many water molecules are produced? 3) Determine the mass of calcium sulfate that is created. 4) Calculate the volume of NH3 gas that is produced under STP conditions. (NH4)2SO4 + Ca(OH)2 → 2NH3 + CaSO4 + 2H2O For all answers, you also need to select the correct units.

Lemon juice can be used to remove the odor of fish on a person's hands after cleaning fish. The chemical explanation for this is that the pleasant odor of the lemon juice covers the fishy odor acid in the lemon juice reacts with the odor-causing amines to form an odorless ammonium compound lemon juice dilutes the odor-causing amines O lemon juice removes the bitter flavor often associated with nitrogen compounds

A reaction consumes 5.0 g of A and 6.0 g of B. How many grams of C and D should be obtained? IA +3B -> 2C+4D Not enough information is given to answer this question. 10 23 11

Arrange the fatty acids from highest melting point to lowest melting point. CH3(CH2)5CH=CH3(CH2)12COOH CH3(CH2)12COOH CH3(CH2)4(CH=CHCH2)4(CH2)2COOH CH3(CH2)16COOH

One of the radioactive isotopes used in medical treatment or analysis is palladium-103. The half-life of palladium-103 is 17 days. How many days is/are required for the activity of a sample of palladium-103 to fall to 12.5 percent of its original value?